C19H24N2 — CID 43483949
1-(9H-carbazol-3-yl)-N,4-dimethylpentan-1-amine (PubChem CID 43483949) has the molecular formula C19H24N2 and a molecular weight of 280.41 g/mol. Its IUPAC name is 1-(9H-carbazol-3-yl)-N,4-dimethylpentan-1-amine.
| Compound Name | 1-(9H-carbazol-3-yl)-N,4-dimethylpentan-1-amine |
|---|---|
| PubChem CID | 43483949 |
| Molecular Formula | C19H24N2 |
| Molecular Weight | 280.41 g/mol |
| Exact Mass | 280.19 |
| IUPAC Name | 1-(9H-carbazol-3-yl)-N,4-dimethylpentan-1-amine |
| SMILES | CNC(CCC(C)C)c1ccc2[nH]c3ccccc3c2c1 |
| InChI | InChI=1S/C19H24N2/c1-13(2)8-10-17(20-3)14-9-11-19-16(12-14)15-6-4-5-7-18(15)21-19/h4-7,9,11-13,17,20-21H,8,10H2,1-3H3 |
| InChIKey | PZKZHSJOSMLVLB-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 27.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.41 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |