C18H21F2N — CID 43484333
1-(4-butylphenyl)-1-(3,4-difluorophenyl)-N-methylmethanamine (PubChem CID 43484333) has the molecular formula C18H21F2N and a molecular weight of 289.37 g/mol. Its IUPAC name is 1-(4-butylphenyl)-1-(3,4-difluorophenyl)-N-methylmethanamine.
| Compound Name | 1-(4-butylphenyl)-1-(3,4-difluorophenyl)-N-methylmethanamine |
|---|---|
| PubChem CID | 43484333 |
| Molecular Formula | C18H21F2N |
| Molecular Weight | 289.37 g/mol |
| Exact Mass | 289.16 |
| IUPAC Name | 1-(4-butylphenyl)-1-(3,4-difluorophenyl)-N-methylmethanamine |
| SMILES | CCCCc1ccc(C(NC)c2ccc(F)c(F)c2)cc1 |
| InChI | InChI=1S/C18H21F2N/c1-3-4-5-13-6-8-14(9-7-13)18(21-2)15-10-11-16(19)17(20)12-15/h6-12,18,21H,3-5H2,1-2H3 |
| InChIKey | LQSUEHLIBMYWMH-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.37 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |