C19H25N — CID 43484460
1-(4-tert-butylphenyl)-N-methyl-1-(2-methylphenyl)methanamine (PubChem CID 43484460) has the molecular formula C19H25N and a molecular weight of 267.42 g/mol. Its IUPAC name is 1-(4-tert-butylphenyl)-N-methyl-1-(2-methylphenyl)methanamine.
| Compound Name | 1-(4-tert-butylphenyl)-N-methyl-1-(2-methylphenyl)methanamine |
|---|---|
| PubChem CID | 43484460 |
| Molecular Formula | C19H25N |
| Molecular Weight | 267.42 g/mol |
| Exact Mass | 267.20 |
| IUPAC Name | 1-(4-tert-butylphenyl)-N-methyl-1-(2-methylphenyl)methanamine |
| SMILES | CNC(c1ccc(C(C)(C)C)cc1)c1ccccc1C |
| InChI | InChI=1S/C19H25N/c1-14-8-6-7-9-17(14)18(20-5)15-10-12-16(13-11-15)19(2,3)4/h6-13,18,20H,1-5H3 |
| InChIKey | OUNLMVUXIIOZHF-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.42 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |