C8H10F5N3 — CID 43485857
2,2,3,3,3-pentafluoro-N-methyl-1-(1-methylpyrazol-4-yl)propan-1-amine (PubChem CID 43485857) has the molecular formula C8H10F5N3 and a molecular weight of 243.18 g/mol. Its IUPAC name is 2,2,3,3,3-pentafluoro-N-methyl-1-(1-methylpyrazol-4-yl)propan-1-amine.
| Compound Name | 2,2,3,3,3-pentafluoro-N-methyl-1-(1-methylpyrazol-4-yl)propan-1-amine |
|---|---|
| PubChem CID | 43485857 |
| Molecular Formula | C8H10F5N3 |
| Molecular Weight | 243.18 g/mol |
| Exact Mass | 243.08 |
| IUPAC Name | 2,2,3,3,3-pentafluoro-N-methyl-1-(1-methylpyrazol-4-yl)propan-1-amine |
| SMILES | CNC(c1cnn(C)c1)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C8H10F5N3/c1-14-6(5-3-15-16(2)4-5)7(9,10)8(11,12)13/h3-4,6,14H,1-2H3 |
| InChIKey | JDQUQPMMEVICOW-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.18 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|