C15H15N3O3 — CID 43490490
6-[ethylamino(furan-2-yl)methyl]-1,4-dihydroquinoxaline-2,3-dione (PubChem CID 43490490) has the molecular formula C15H15N3O3 and a molecular weight of 285.30 g/mol. Its IUPAC name is 6-[ethylamino(furan-2-yl)methyl]-1,4-dihydroquinoxaline-2,3-dione.
| Compound Name | 6-[ethylamino(furan-2-yl)methyl]-1,4-dihydroquinoxaline-2,3-dione |
|---|---|
| PubChem CID | 43490490 |
| Molecular Formula | C15H15N3O3 |
| Molecular Weight | 285.30 g/mol |
| Exact Mass | 285.11 |
| IUPAC Name | 6-[ethylamino(furan-2-yl)methyl]-1,4-dihydroquinoxaline-2,3-dione |
| SMILES | CCNC(c1ccc2[nH]c(=O)c(=O)[nH]c2c1)c1ccco1 |
| InChI | InChI=1S/C15H15N3O3/c1-2-16-13(12-4-3-7-21-12)9-5-6-10-11(8-9)18-15(20)14(19)17-10/h3-8,13,16H,2H2,1H3,(H,17,19)(H,18,20) |
| InChIKey | OWMBFALANKSXIZ-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 90.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.30 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|