C17H19N3O — CID 43490689
5-[1-(ethylamino)-2-phenylethyl]-1,3-dihydrobenzimidazol-2-one (PubChem CID 43490689) has the molecular formula C17H19N3O and a molecular weight of 281.36 g/mol. Its IUPAC name is 5-[1-(ethylamino)-2-phenylethyl]-1,3-dihydrobenzimidazol-2-one.
| Compound Name | 5-[1-(ethylamino)-2-phenylethyl]-1,3-dihydrobenzimidazol-2-one |
|---|---|
| PubChem CID | 43490689 |
| Molecular Formula | C17H19N3O |
| Molecular Weight | 281.36 g/mol |
| Exact Mass | 281.15 |
| IUPAC Name | 5-[1-(ethylamino)-2-phenylethyl]-1,3-dihydrobenzimidazol-2-one |
| SMILES | CCNC(Cc1ccccc1)c1ccc2[nH]c(=O)[nH]c2c1 |
| InChI | InChI=1S/C17H19N3O/c1-2-18-15(10-12-6-4-3-5-7-12)13-8-9-14-16(11-13)20-17(21)19-14/h3-9,11,15,18H,2,10H2,1H3,(H2,19,20,21) |
| InChIKey | OWSGAKNSMUKPAO-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 60.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.36 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |