C9H12F5N3 — CID 43492384
N-ethyl-2,2,3,3,3-pentafluoro-1-(1-methylpyrazol-4-yl)propan-1-amine (PubChem CID 43492384) has the molecular formula C9H12F5N3 and a molecular weight of 257.21 g/mol. Its IUPAC name is N-ethyl-2,2,3,3,3-pentafluoro-1-(1-methylpyrazol-4-yl)propan-1-amine.
| Compound Name | N-ethyl-2,2,3,3,3-pentafluoro-1-(1-methylpyrazol-4-yl)propan-1-amine |
|---|---|
| PubChem CID | 43492384 |
| Molecular Formula | C9H12F5N3 |
| Molecular Weight | 257.21 g/mol |
| Exact Mass | 257.10 |
| IUPAC Name | N-ethyl-2,2,3,3,3-pentafluoro-1-(1-methylpyrazol-4-yl)propan-1-amine |
| SMILES | CCNC(c1cnn(C)c1)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C9H12F5N3/c1-3-15-7(6-4-16-17(2)5-6)8(10,11)9(12,13)14/h4-5,7,15H,3H2,1-2H3 |
| InChIKey | HHSZKYCURGRSKA-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.21 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|