C16H27NO2 — CID 43495216
1-(2,5-dimethoxyphenyl)-2,2-dimethyl-N-propylpropan-1-amine (PubChem CID 43495216) has the molecular formula C16H27NO2 and a molecular weight of 265.40 g/mol. Its IUPAC name is 1-(2,5-dimethoxyphenyl)-2,2-dimethyl-N-propylpropan-1-amine.
| Compound Name | 1-(2,5-dimethoxyphenyl)-2,2-dimethyl-N-propylpropan-1-amine |
|---|---|
| PubChem CID | 43495216 |
| Molecular Formula | C16H27NO2 |
| Molecular Weight | 265.40 g/mol |
| Exact Mass | 265.20 |
| IUPAC Name | 1-(2,5-dimethoxyphenyl)-2,2-dimethyl-N-propylpropan-1-amine |
| SMILES | CCCNC(c1cc(OC)ccc1OC)C(C)(C)C |
| InChI | InChI=1S/C16H27NO2/c1-7-10-17-15(16(2,3)4)13-11-12(18-5)8-9-14(13)19-6/h8-9,11,15,17H,7,10H2,1-6H3 |
| InChIKey | MVPMJMZXYQOSGJ-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.40 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |