C15H21N3O2 — CID 43495871
6-[1-(propylamino)butyl]-1,4-dihydroquinoxaline-2,3-dione (PubChem CID 43495871) has the molecular formula C15H21N3O2 and a molecular weight of 275.35 g/mol. Its IUPAC name is 6-[1-(propylamino)butyl]-1,4-dihydroquinoxaline-2,3-dione.
| Compound Name | 6-[1-(propylamino)butyl]-1,4-dihydroquinoxaline-2,3-dione |
|---|---|
| PubChem CID | 43495871 |
| Molecular Formula | C15H21N3O2 |
| Molecular Weight | 275.35 g/mol |
| Exact Mass | 275.16 |
| IUPAC Name | 6-[1-(propylamino)butyl]-1,4-dihydroquinoxaline-2,3-dione |
| SMILES | CCCNC(CCC)c1ccc2[nH]c(=O)c(=O)[nH]c2c1 |
| InChI | InChI=1S/C15H21N3O2/c1-3-5-11(16-8-4-2)10-6-7-12-13(9-10)18-15(20)14(19)17-12/h6-7,9,11,16H,3-5,8H2,1-2H3,(H,17,19)(H,18,20) |
| InChIKey | XZTKQJVXJVBWBW-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 77.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.35 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|