C18H27N3 — CID 43497373
3,3-dimethyl-1-(1-phenylpyrazol-4-yl)-N-propylbutan-1-amine (PubChem CID 43497373) has the molecular formula C18H27N3 and a molecular weight of 285.43 g/mol. Its IUPAC name is 3,3-dimethyl-1-(1-phenylpyrazol-4-yl)-N-propylbutan-1-amine.
| Compound Name | 3,3-dimethyl-1-(1-phenylpyrazol-4-yl)-N-propylbutan-1-amine |
|---|---|
| PubChem CID | 43497373 |
| Molecular Formula | C18H27N3 |
| Molecular Weight | 285.43 g/mol |
| Exact Mass | 285.22 |
| IUPAC Name | 3,3-dimethyl-1-(1-phenylpyrazol-4-yl)-N-propylbutan-1-amine |
| SMILES | CCCNC(CC(C)(C)C)c1cnn(-c2ccccc2)c1 |
| InChI | InChI=1S/C18H27N3/c1-5-11-19-17(12-18(2,3)4)15-13-20-21(14-15)16-9-7-6-8-10-16/h6-10,13-14,17,19H,5,11-12H2,1-4H3 |
| InChIKey | MZDRPDNPWFZHEV-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.43 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |