C16H15Cl4N — CID 43497710
N-[bis(2,5-dichlorophenyl)methyl]propan-1-amine (PubChem CID 43497710) has the molecular formula C16H15Cl4N and a molecular weight of 363.12 g/mol. Its IUPAC name is N-[bis(2,5-dichlorophenyl)methyl]propan-1-amine.
| Compound Name | N-[bis(2,5-dichlorophenyl)methyl]propan-1-amine |
|---|---|
| PubChem CID | 43497710 |
| Molecular Formula | C16H15Cl4N |
| Molecular Weight | 363.12 g/mol |
| Exact Mass | 361.00 |
| IUPAC Name | N-[bis(2,5-dichlorophenyl)methyl]propan-1-amine |
| SMILES | CCCNC(c1cc(Cl)ccc1Cl)c1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C16H15Cl4N/c1-2-7-21-16(12-8-10(17)3-5-14(12)19)13-9-11(18)4-6-15(13)20/h3-6,8-9,16,21H,2,7H2,1H3 |
| InChIKey | IPVLMPOTQIJEGK-UHFFFAOYSA-N |
| XLogP | 6.39 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.12 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |