C17H21Br2NS — CID 43497928
1-(2,5-dibromothiophen-3-yl)-2-phenyl-N-propylbutan-1-amine (PubChem CID 43497928) has the molecular formula C17H21Br2NS and a molecular weight of 431.24 g/mol. Its IUPAC name is 1-(2,5-dibromothiophen-3-yl)-2-phenyl-N-propylbutan-1-amine.
| Compound Name | 1-(2,5-dibromothiophen-3-yl)-2-phenyl-N-propylbutan-1-amine |
|---|---|
| PubChem CID | 43497928 |
| Molecular Formula | C17H21Br2NS |
| Molecular Weight | 431.24 g/mol |
| Exact Mass | 428.98 |
| IUPAC Name | 1-(2,5-dibromothiophen-3-yl)-2-phenyl-N-propylbutan-1-amine |
| SMILES | CCCNC(c1cc(Br)sc1Br)C(CC)c1ccccc1 |
| InChI | InChI=1S/C17H21Br2NS/c1-3-10-20-16(14-11-15(18)21-17(14)19)13(4-2)12-8-6-5-7-9-12/h5-9,11,13,16,20H,3-4,10H2,1-2H3 |
| InChIKey | SKLRXKMGPWLRBN-UHFFFAOYSA-N |
| XLogP | 6.51 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.24 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |