C18H33N3 — CID 43498023
N-[1-(4-butylcyclohexyl)-2-(1H-imidazol-2-yl)ethyl]propan-1-amine (PubChem CID 43498023) has the molecular formula C18H33N3 and a molecular weight of 291.48 g/mol. Its IUPAC name is N-[1-(4-butylcyclohexyl)-2-(1H-imidazol-2-yl)ethyl]propan-1-amine.
| Compound Name | N-[1-(4-butylcyclohexyl)-2-(1H-imidazol-2-yl)ethyl]propan-1-amine |
|---|---|
| PubChem CID | 43498023 |
| Molecular Formula | C18H33N3 |
| Molecular Weight | 291.48 g/mol |
| Exact Mass | 291.27 |
| IUPAC Name | N-[1-(4-butylcyclohexyl)-2-(1H-imidazol-2-yl)ethyl]propan-1-amine |
| SMILES | CCCCC1CCC(C(Cc2ncc[nH]2)NCCC)CC1 |
| InChI | InChI=1S/C18H33N3/c1-3-5-6-15-7-9-16(10-8-15)17(19-11-4-2)14-18-20-12-13-21-18/h12-13,15-17,19H,3-11,14H2,1-2H3,(H,20,21) |
| InChIKey | NCGYNIASYZVUDJ-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 40.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.48 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |