C14H23NO — CID 43498177
1-(4-methoxy-3-methylphenyl)-N-propylpropan-1-amine (PubChem CID 43498177) has the molecular formula C14H23NO and a molecular weight of 221.34 g/mol. Its IUPAC name is 1-(4-methoxy-3-methylphenyl)-N-propylpropan-1-amine.
| Compound Name | 1-(4-methoxy-3-methylphenyl)-N-propylpropan-1-amine |
|---|---|
| PubChem CID | 43498177 |
| Molecular Formula | C14H23NO |
| Molecular Weight | 221.34 g/mol |
| Exact Mass | 221.18 |
| IUPAC Name | 1-(4-methoxy-3-methylphenyl)-N-propylpropan-1-amine |
| SMILES | CCCNC(CC)c1ccc(OC)c(C)c1 |
| InChI | InChI=1S/C14H23NO/c1-5-9-15-13(6-2)12-7-8-14(16-4)11(3)10-12/h7-8,10,13,15H,5-6,9H2,1-4H3 |
| InChIKey | BDLBDQQKZJIIGW-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.34 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |