C15H17BrFNOS — CID 43498263
N-[(5-bromothiophen-2-yl)-(3-fluoro-4-methoxyphenyl)methyl]propan-1-amine (PubChem CID 43498263) has the molecular formula C15H17BrFNOS and a molecular weight of 358.28 g/mol. Its IUPAC name is N-[(5-bromothiophen-2-yl)-(3-fluoro-4-methoxyphenyl)methyl]propan-1-amine.
| Compound Name | N-[(5-bromothiophen-2-yl)-(3-fluoro-4-methoxyphenyl)methyl]propan-1-amine |
|---|---|
| PubChem CID | 43498263 |
| Molecular Formula | C15H17BrFNOS |
| Molecular Weight | 358.28 g/mol |
| Exact Mass | 357.02 |
| IUPAC Name | N-[(5-bromothiophen-2-yl)-(3-fluoro-4-methoxyphenyl)methyl]propan-1-amine |
| SMILES | CCCNC(c1ccc(OC)c(F)c1)c1ccc(Br)s1 |
| InChI | InChI=1S/C15H17BrFNOS/c1-3-8-18-15(13-6-7-14(16)20-13)10-4-5-12(19-2)11(17)9-10/h4-7,9,15,18H,3,8H2,1-2H3 |
| InChIKey | JOQPPFCSEBTRDD-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.28 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |