C11H21NO — CID 43498441
7-ethyl-2,3,4,5,5a,6,7,8,9,9a-decahydrobenzo[b][1,4]oxazepine (PubChem CID 43498441) has the molecular formula C11H21NO and a molecular weight of 183.29 g/mol. Its IUPAC name is 7-ethyl-2,3,4,5,5a,6,7,8,9,9a-decahydrobenzo[b][1,4]oxazepine.
| Compound Name | 7-ethyl-2,3,4,5,5a,6,7,8,9,9a-decahydrobenzo[b][1,4]oxazepine |
|---|---|
| PubChem CID | 43498441 |
| Molecular Formula | C11H21NO |
| Molecular Weight | 183.29 g/mol |
| Exact Mass | 183.16 |
| IUPAC Name | 7-ethyl-2,3,4,5,5a,6,7,8,9,9a-decahydrobenzo[b][1,4]oxazepine |
| SMILES | CCC1CCC2OCCCNC2C1 |
| InChI | InChI=1S/C11H21NO/c1-2-9-4-5-11-10(8-9)12-6-3-7-13-11/h9-12H,2-8H2,1H3 |
| InChIKey | IGWKBJSVSRILIB-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.29 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |