C16H18N2O2 — CID 43498529
2-(2-aminophenyl)-N-(2-hydroxy-2-phenylethyl)acetamide (PubChem CID 43498529) has the molecular formula C16H18N2O2 and a molecular weight of 270.33 g/mol. Its IUPAC name is 2-(2-aminophenyl)-N-(2-hydroxy-2-phenylethyl)acetamide.
| Compound Name | 2-(2-aminophenyl)-N-(2-hydroxy-2-phenylethyl)acetamide |
|---|---|
| PubChem CID | 43498529 |
| Molecular Formula | C16H18N2O2 |
| Molecular Weight | 270.33 g/mol |
| Exact Mass | 270.14 |
| IUPAC Name | 2-(2-aminophenyl)-N-(2-hydroxy-2-phenylethyl)acetamide |
| SMILES | Nc1ccccc1CC(=O)NCC(O)c1ccccc1 |
| InChI | InChI=1S/C16H18N2O2/c17-14-9-5-4-8-13(14)10-16(20)18-11-15(19)12-6-2-1-3-7-12/h1-9,15,19H,10-11,17H2,(H,18,20) |
| InChIKey | WKACZGQFBRNUFA-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.33 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|