About 2-(1,3-thiazol-2-ylamino)propan-1-ol
2-(1,3-thiazol-2-ylamino)propan-1-ol (PubChem CID 43500313) has the molecular formula C6H10N2OS
and a molecular weight of 158.23 g/mol. Its IUPAC name is 2-(1,3-thiazol-2-ylamino)propan-1-ol.
Molecular Properties
| Compound Name | 2-(1,3-thiazol-2-ylamino)propan-1-ol |
| PubChem CID | 43500313 |
| Molecular Formula | C6H10N2OS |
| Molecular Weight | 158.23 g/mol |
| Exact Mass | 158.05 |
| IUPAC Name | 2-(1,3-thiazol-2-ylamino)propan-1-ol |
| SMILES | CC(CO)Nc1nccs1 |
| InChI | InChI=1S/C6H10N2OS/c1-5(4-9)8-6-7-2-3-10-6/h2-3,5,9H,4H2,1H3,(H,7,8) |
| InChIKey | VLFPLNQDWAZURZ-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 45.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 158.23 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(1,3-thiazol-2-ylamino)propan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1,3-thiazol-2-ylamino)propan-1-ol?
The IUPAC name of 2-(1,3-thiazol-2-ylamino)propan-1-ol (CID 43500313) is 2-(1,3-thiazol-2-ylamino)propan-1-ol.
What is the SMILES notation for 2-(1,3-thiazol-2-ylamino)propan-1-ol?
The canonical SMILES for 2-(1,3-thiazol-2-ylamino)propan-1-ol is CC(CO)Nc1nccs1.
What is the InChIKey of 2-(1,3-thiazol-2-ylamino)propan-1-ol?
The InChIKey is VLFPLNQDWAZURZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10N2OS/c1-5(4-9)8-6-7-2-3-10-6/h2-3,5,9H,4H2,1H3,(H,7,8).
What are the key properties of 2-(1,3-thiazol-2-ylamino)propan-1-ol?
2-(1,3-thiazol-2-ylamino)propan-1-ol has a molecular weight of 158.23 g/mol, XLogP of 0.94, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1,3-thiazol-2-ylamino)propan-1-ol is sourced from PubChem (CID 43500313), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).