About N-(3-hydroxypropyl)-2,4-dioxo-1H-pyrimidine-6-carboxamide
N-(3-hydroxypropyl)-2,4-dioxo-1H-pyrimidine-6-carboxamide (PubChem CID 43500353) has the molecular formula C8H11N3O4
and a molecular weight of 213.19 g/mol. Its IUPAC name is N-(3-hydroxypropyl)-2,4-dioxo-1H-pyrimidine-6-carboxamide.
Molecular Properties
| Compound Name | N-(3-hydroxypropyl)-2,4-dioxo-1H-pyrimidine-6-carboxamide |
| PubChem CID | 43500353 |
| Molecular Formula | C8H11N3O4 |
| Molecular Weight | 213.19 g/mol |
| Exact Mass | 213.07 |
| IUPAC Name | N-(3-hydroxypropyl)-2,4-dioxo-1H-pyrimidine-6-carboxamide |
| SMILES | O=C(NCCCO)c1cc(=O)[nH]c(=O)[nH]1 |
| InChI | InChI=1S/C8H11N3O4/c12-3-1-2-9-7(14)5-4-6(13)11-8(15)10-5/h4,12H,1-3H2,(H,9,14)(H2,10,11,13,15) |
| InChIKey | UVFMVOOGAVJIMJ-UHFFFAOYSA-N |
| XLogP | -1.82 |
| TPSA | 115.05 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 213.19 |
| LogP ≤ 5 | -1.82 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-(3-hydroxypropyl)-2,4-dioxo-1H-pyrimidine-6-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(3-hydroxypropyl)-2,4-dioxo-1H-pyrimidine-6-carboxamide?
The IUPAC name of N-(3-hydroxypropyl)-2,4-dioxo-1H-pyrimidine-6-carboxamide (CID 43500353) is N-(3-hydroxypropyl)-2,4-dioxo-1H-pyrimidine-6-carboxamide.
What is the SMILES notation for N-(3-hydroxypropyl)-2,4-dioxo-1H-pyrimidine-6-carboxamide?
The canonical SMILES for N-(3-hydroxypropyl)-2,4-dioxo-1H-pyrimidine-6-carboxamide is O=C(NCCCO)c1cc(=O)[nH]c(=O)[nH]1.
What is the InChIKey of N-(3-hydroxypropyl)-2,4-dioxo-1H-pyrimidine-6-carboxamide?
The InChIKey is UVFMVOOGAVJIMJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11N3O4/c12-3-1-2-9-7(14)5-4-6(13)11-8(15)10-5/h4,12H,1-3H2,(H,9,14)(H2,10,11,13,15).
What are the key properties of N-(3-hydroxypropyl)-2,4-dioxo-1H-pyrimidine-6-carboxamide?
N-(3-hydroxypropyl)-2,4-dioxo-1H-pyrimidine-6-carboxamide has a molecular weight of 213.19 g/mol, XLogP of -1.82, 4 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(3-hydroxypropyl)-2,4-dioxo-1H-pyrimidine-6-carboxamide is sourced from PubChem (CID 43500353), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).