C7H9N3O3 — CID 43501009
N-(2-hydroxyethyl)-6-oxo-1H-pyrazine-3-carboxamide (PubChem CID 43501009) has the molecular formula C7H9N3O3 and a molecular weight of 183.17 g/mol. Its IUPAC name is N-(2-hydroxyethyl)-6-oxo-1H-pyrazine-3-carboxamide.
| Compound Name | N-(2-hydroxyethyl)-6-oxo-1H-pyrazine-3-carboxamide |
|---|---|
| PubChem CID | 43501009 |
| Molecular Formula | C7H9N3O3 |
| Molecular Weight | 183.17 g/mol |
| Exact Mass | 183.06 |
| IUPAC Name | N-(2-hydroxyethyl)-6-oxo-1H-pyrazine-3-carboxamide |
| SMILES | O=C(NCCO)c1c[nH]c(=O)cn1 |
| InChI | InChI=1S/C7H9N3O3/c11-2-1-8-7(13)5-3-10-6(12)4-9-5/h3-4,11H,1-2H2,(H,8,13)(H,10,12) |
| InChIKey | PUHLYQWBMXYTMY-UHFFFAOYSA-N |
| XLogP | -1.51 |
| TPSA | 95.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.17 |
| LogP ≤ 5 | -1.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |