About N-(3-hydroxypropyl)-2,6-dimethylmorpholine-4-sulfonamide
N-(3-hydroxypropyl)-2,6-dimethylmorpholine-4-sulfonamide (PubChem CID 43501428) has the molecular formula C9H20N2O4S
and a molecular weight of 252.34 g/mol. Its IUPAC name is N-(3-hydroxypropyl)-2,6-dimethylmorpholine-4-sulfonamide.
Molecular Properties
| Compound Name | N-(3-hydroxypropyl)-2,6-dimethylmorpholine-4-sulfonamide |
| PubChem CID | 43501428 |
| Molecular Formula | C9H20N2O4S |
| Molecular Weight | 252.34 g/mol |
| Exact Mass | 252.11 |
| IUPAC Name | N-(3-hydroxypropyl)-2,6-dimethylmorpholine-4-sulfonamide |
| SMILES | CC1CN(S(=O)(=O)NCCCO)CC(C)O1 |
| InChI | InChI=1S/C9H20N2O4S/c1-8-6-11(7-9(2)15-8)16(13,14)10-4-3-5-12/h8-10,12H,3-7H2,1-2H3 |
| InChIKey | SJXOBGLTQDIWPT-UHFFFAOYSA-N |
| XLogP | -0.69 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.34 |
| LogP ≤ 5 | -0.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-(3-hydroxypropyl)-2,6-dimethylmorpholine-4-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(3-hydroxypropyl)-2,6-dimethylmorpholine-4-sulfonamide?
The IUPAC name of N-(3-hydroxypropyl)-2,6-dimethylmorpholine-4-sulfonamide (CID 43501428) is N-(3-hydroxypropyl)-2,6-dimethylmorpholine-4-sulfonamide.
What is the SMILES notation for N-(3-hydroxypropyl)-2,6-dimethylmorpholine-4-sulfonamide?
The canonical SMILES for N-(3-hydroxypropyl)-2,6-dimethylmorpholine-4-sulfonamide is CC1CN(S(=O)(=O)NCCCO)CC(C)O1.
What is the InChIKey of N-(3-hydroxypropyl)-2,6-dimethylmorpholine-4-sulfonamide?
The InChIKey is SJXOBGLTQDIWPT-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H20N2O4S/c1-8-6-11(7-9(2)15-8)16(13,14)10-4-3-5-12/h8-10,12H,3-7H2,1-2H3.
What are the key properties of N-(3-hydroxypropyl)-2,6-dimethylmorpholine-4-sulfonamide?
N-(3-hydroxypropyl)-2,6-dimethylmorpholine-4-sulfonamide has a molecular weight of 252.34 g/mol, XLogP of -0.69, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(3-hydroxypropyl)-2,6-dimethylmorpholine-4-sulfonamide is sourced from PubChem (CID 43501428), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).