C10H16N2O5S2 — CID 43501515
4-N-(3-hydroxypropyl)-1-N-methylbenzene-1,4-disulfonamide (PubChem CID 43501515) has the molecular formula C10H16N2O5S2 and a molecular weight of 308.38 g/mol. Its IUPAC name is 4-N-(3-hydroxypropyl)-1-N-methylbenzene-1,4-disulfonamide.
| Compound Name | 4-N-(3-hydroxypropyl)-1-N-methylbenzene-1,4-disulfonamide |
|---|---|
| PubChem CID | 43501515 |
| Molecular Formula | C10H16N2O5S2 |
| Molecular Weight | 308.38 g/mol |
| Exact Mass | 308.05 |
| IUPAC Name | 4-N-(3-hydroxypropyl)-1-N-methylbenzene-1,4-disulfonamide |
| SMILES | CNS(=O)(=O)c1ccc(S(=O)(=O)NCCCO)cc1 |
| InChI | InChI=1S/C10H16N2O5S2/c1-11-18(14,15)9-3-5-10(6-4-9)19(16,17)12-7-2-8-13/h3-6,11-13H,2,7-8H2,1H3 |
| InChIKey | VNJZTKSGWMXDOD-UHFFFAOYSA-N |
| XLogP | -0.74 |
| TPSA | 112.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.38 |
| LogP ≤ 5 | -0.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|