About N-(2-hydroxypropyl)-3,5-dimethylpiperidine-1-sulfonamide
N-(2-hydroxypropyl)-3,5-dimethylpiperidine-1-sulfonamide (PubChem CID 43502311) has the molecular formula C10H22N2O3S
and a molecular weight of 250.36 g/mol. Its IUPAC name is N-(2-hydroxypropyl)-3,5-dimethylpiperidine-1-sulfonamide.
Molecular Properties
| Compound Name | N-(2-hydroxypropyl)-3,5-dimethylpiperidine-1-sulfonamide |
| PubChem CID | 43502311 |
| Molecular Formula | C10H22N2O3S |
| Molecular Weight | 250.36 g/mol |
| Exact Mass | 250.14 |
| IUPAC Name | N-(2-hydroxypropyl)-3,5-dimethylpiperidine-1-sulfonamide |
| SMILES | CC(O)CNS(=O)(=O)N1CC(C)CC(C)C1 |
| InChI | InChI=1S/C10H22N2O3S/c1-8-4-9(2)7-12(6-8)16(14,15)11-5-10(3)13/h8-11,13H,4-7H2,1-3H3 |
| InChIKey | ISQDTIXEIQIODK-UHFFFAOYSA-N |
| XLogP | 0.18 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.36 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-(2-hydroxypropyl)-3,5-dimethylpiperidine-1-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-hydroxypropyl)-3,5-dimethylpiperidine-1-sulfonamide?
The IUPAC name of N-(2-hydroxypropyl)-3,5-dimethylpiperidine-1-sulfonamide (CID 43502311) is N-(2-hydroxypropyl)-3,5-dimethylpiperidine-1-sulfonamide.
What is the SMILES notation for N-(2-hydroxypropyl)-3,5-dimethylpiperidine-1-sulfonamide?
The canonical SMILES for N-(2-hydroxypropyl)-3,5-dimethylpiperidine-1-sulfonamide is CC(O)CNS(=O)(=O)N1CC(C)CC(C)C1.
What is the InChIKey of N-(2-hydroxypropyl)-3,5-dimethylpiperidine-1-sulfonamide?
The InChIKey is ISQDTIXEIQIODK-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H22N2O3S/c1-8-4-9(2)7-12(6-8)16(14,15)11-5-10(3)13/h8-11,13H,4-7H2,1-3H3.
What are the key properties of N-(2-hydroxypropyl)-3,5-dimethylpiperidine-1-sulfonamide?
N-(2-hydroxypropyl)-3,5-dimethylpiperidine-1-sulfonamide has a molecular weight of 250.36 g/mol, XLogP of 0.18, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-hydroxypropyl)-3,5-dimethylpiperidine-1-sulfonamide is sourced from PubChem (CID 43502311), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).