C12H17NO3 — CID 43504037
N-ethyl-2-[2-(1-hydroxyethyl)phenoxy]acetamide (PubChem CID 43504037) has the molecular formula C12H17NO3 and a molecular weight of 223.27 g/mol. Its IUPAC name is N-ethyl-2-[2-(1-hydroxyethyl)phenoxy]acetamide.
| Compound Name | N-ethyl-2-[2-(1-hydroxyethyl)phenoxy]acetamide |
|---|---|
| PubChem CID | 43504037 |
| Molecular Formula | C12H17NO3 |
| Molecular Weight | 223.27 g/mol |
| Exact Mass | 223.12 |
| IUPAC Name | N-ethyl-2-[2-(1-hydroxyethyl)phenoxy]acetamide |
| SMILES | CCNC(=O)COc1ccccc1C(C)O |
| InChI | InChI=1S/C12H17NO3/c1-3-13-12(15)8-16-11-7-5-4-6-10(11)9(2)14/h4-7,9,14H,3,8H2,1-2H3,(H,13,15) |
| InChIKey | YKPZMTYQVRLLAN-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.27 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |