C12H17F2NO — CID 43505197
1-[2-(difluoromethoxy)-5-methylphenyl]-N-ethylethanamine (PubChem CID 43505197) has the molecular formula C12H17F2NO and a molecular weight of 229.27 g/mol. Its IUPAC name is 1-[2-(difluoromethoxy)-5-methylphenyl]-N-ethylethanamine.
| Compound Name | 1-[2-(difluoromethoxy)-5-methylphenyl]-N-ethylethanamine |
|---|---|
| PubChem CID | 43505197 |
| Molecular Formula | C12H17F2NO |
| Molecular Weight | 229.27 g/mol |
| Exact Mass | 229.13 |
| IUPAC Name | 1-[2-(difluoromethoxy)-5-methylphenyl]-N-ethylethanamine |
| SMILES | CCNC(C)c1cc(C)ccc1OC(F)F |
| InChI | InChI=1S/C12H17F2NO/c1-4-15-9(3)10-7-8(2)5-6-11(10)16-12(13)14/h5-7,9,12,15H,4H2,1-3H3 |
| InChIKey | WKDKKVGVKPEEQW-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.27 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |