C17H19FO2 — CID 43506596
1-[5-fluoro-2-(2,3,6-trimethylphenoxy)phenyl]ethanol (PubChem CID 43506596) has the molecular formula C17H19FO2 and a molecular weight of 274.34 g/mol. Its IUPAC name is 1-[5-fluoro-2-(2,3,6-trimethylphenoxy)phenyl]ethanol.
| Compound Name | 1-[5-fluoro-2-(2,3,6-trimethylphenoxy)phenyl]ethanol |
|---|---|
| PubChem CID | 43506596 |
| Molecular Formula | C17H19FO2 |
| Molecular Weight | 274.34 g/mol |
| Exact Mass | 274.14 |
| IUPAC Name | 1-[5-fluoro-2-(2,3,6-trimethylphenoxy)phenyl]ethanol |
| SMILES | Cc1ccc(C)c(Oc2ccc(F)cc2C(C)O)c1C |
| InChI | InChI=1S/C17H19FO2/c1-10-5-6-11(2)17(12(10)3)20-16-8-7-14(18)9-15(16)13(4)19/h5-9,13,19H,1-4H3 |
| InChIKey | AKIXXLYRWQPISS-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.34 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |