C14H13F2NO3S — CID 43508632
2,5-difluoro-N-[3-(1-hydroxyethyl)phenyl]benzenesulfonamide (PubChem CID 43508632) has the molecular formula C14H13F2NO3S and a molecular weight of 313.33 g/mol. Its IUPAC name is 2,5-difluoro-N-[3-(1-hydroxyethyl)phenyl]benzenesulfonamide.
| Compound Name | 2,5-difluoro-N-[3-(1-hydroxyethyl)phenyl]benzenesulfonamide |
|---|---|
| PubChem CID | 43508632 |
| Molecular Formula | C14H13F2NO3S |
| Molecular Weight | 313.33 g/mol |
| Exact Mass | 313.06 |
| IUPAC Name | 2,5-difluoro-N-[3-(1-hydroxyethyl)phenyl]benzenesulfonamide |
| SMILES | CC(O)c1cccc(NS(=O)(=O)c2cc(F)ccc2F)c1 |
| InChI | InChI=1S/C14H13F2NO3S/c1-9(18)10-3-2-4-12(7-10)17-21(19,20)14-8-11(15)5-6-13(14)16/h2-9,17-18H,1H3 |
| InChIKey | UWCFZOHZWFFPNN-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.33 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |