C10H19N3O3 — CID 43509608
1-[2-(2-hydroxyethylamino)-2-oxoethyl]piperidine-3-carboxamide (PubChem CID 43509608) has the molecular formula C10H19N3O3 and a molecular weight of 229.28 g/mol. Its IUPAC name is 1-[2-(2-hydroxyethylamino)-2-oxoethyl]piperidine-3-carboxamide.
| Compound Name | 1-[2-(2-hydroxyethylamino)-2-oxoethyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 43509608 |
| Molecular Formula | C10H19N3O3 |
| Molecular Weight | 229.28 g/mol |
| Exact Mass | 229.14 |
| IUPAC Name | 1-[2-(2-hydroxyethylamino)-2-oxoethyl]piperidine-3-carboxamide |
| SMILES | NC(=O)C1CCCN(CC(=O)NCCO)C1 |
| InChI | InChI=1S/C10H19N3O3/c11-10(16)8-2-1-4-13(6-8)7-9(15)12-3-5-14/h8,14H,1-7H2,(H2,11,16)(H,12,15) |
| InChIKey | OMBZNPVKOYYIPR-UHFFFAOYSA-N |
| XLogP | -1.71 |
| TPSA | 95.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.28 |
| LogP ≤ 5 | -1.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |