C16H19N — CID 43510641
2,5-dimethyl-1-(5,6,7,8-tetrahydronaphthalen-1-yl)pyrrole (PubChem CID 43510641) has the molecular formula C16H19N and a molecular weight of 225.34 g/mol. Its IUPAC name is 2,5-dimethyl-1-(5,6,7,8-tetrahydronaphthalen-1-yl)pyrrole.
| Compound Name | 2,5-dimethyl-1-(5,6,7,8-tetrahydronaphthalen-1-yl)pyrrole |
|---|---|
| PubChem CID | 43510641 |
| Molecular Formula | C16H19N |
| Molecular Weight | 225.34 g/mol |
| Exact Mass | 225.15 |
| IUPAC Name | 2,5-dimethyl-1-(5,6,7,8-tetrahydronaphthalen-1-yl)pyrrole |
| SMILES | Cc1ccc(C)n1-c1cccc2c1CCCC2 |
| InChI | InChI=1S/C16H19N/c1-12-10-11-13(2)17(12)16-9-5-7-14-6-3-4-8-15(14)16/h5,7,9-11H,3-4,6,8H2,1-2H3 |
| InChIKey | KWSIKAQWYHQGJU-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.34 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|