C11H9ClFN3O4S — CID 43511161
2-[4-[(4-chloro-2-fluorophenyl)sulfamoyl]pyrazol-1-yl]acetic acid (PubChem CID 43511161) has the molecular formula C11H9ClFN3O4S and a molecular weight of 333.73 g/mol. Its IUPAC name is 2-[4-[(4-chloro-2-fluorophenyl)sulfamoyl]pyrazol-1-yl]acetic acid.
| Compound Name | 2-[4-[(4-chloro-2-fluorophenyl)sulfamoyl]pyrazol-1-yl]acetic acid |
|---|---|
| PubChem CID | 43511161 |
| Molecular Formula | C11H9ClFN3O4S |
| Molecular Weight | 333.73 g/mol |
| Exact Mass | 333.00 |
| IUPAC Name | 2-[4-[(4-chloro-2-fluorophenyl)sulfamoyl]pyrazol-1-yl]acetic acid |
| SMILES | O=C(O)Cn1cc(S(=O)(=O)Nc2ccc(Cl)cc2F)cn1 |
| InChI | InChI=1S/C11H9ClFN3O4S/c12-7-1-2-10(9(13)3-7)15-21(19,20)8-4-14-16(5-8)6-11(17)18/h1-5,15H,6H2,(H,17,18) |
| InChIKey | UQLWKKAMQXMGPC-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 101.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.73 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |