C10H15N3O5S — CID 43511219
2-[4-(3-hydroxypiperidin-1-yl)sulfonylpyrazol-1-yl]acetic acid (PubChem CID 43511219) has the molecular formula C10H15N3O5S and a molecular weight of 289.31 g/mol. Its IUPAC name is 2-[4-(3-hydroxypiperidin-1-yl)sulfonylpyrazol-1-yl]acetic acid.
| Compound Name | 2-[4-(3-hydroxypiperidin-1-yl)sulfonylpyrazol-1-yl]acetic acid |
|---|---|
| PubChem CID | 43511219 |
| Molecular Formula | C10H15N3O5S |
| Molecular Weight | 289.31 g/mol |
| Exact Mass | 289.07 |
| IUPAC Name | 2-[4-(3-hydroxypiperidin-1-yl)sulfonylpyrazol-1-yl]acetic acid |
| SMILES | O=C(O)Cn1cc(S(=O)(=O)N2CCCC(O)C2)cn1 |
| InChI | InChI=1S/C10H15N3O5S/c14-8-2-1-3-13(5-8)19(17,18)9-4-11-12(6-9)7-10(15)16/h4,6,8,14H,1-3,5,7H2,(H,15,16) |
| InChIKey | JVJLELVPDNTFSZ-UHFFFAOYSA-N |
| XLogP | -0.89 |
| TPSA | 112.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.31 |
| LogP ≤ 5 | -0.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |