C12H15Br2NS — CID 43511376
N-(2,6-dibromo-4-methylphenyl)thian-4-amine (PubChem CID 43511376) has the molecular formula C12H15Br2NS and a molecular weight of 365.13 g/mol. Its IUPAC name is N-(2,6-dibromo-4-methylphenyl)thian-4-amine.
| Compound Name | N-(2,6-dibromo-4-methylphenyl)thian-4-amine |
|---|---|
| PubChem CID | 43511376 |
| Molecular Formula | C12H15Br2NS |
| Molecular Weight | 365.13 g/mol |
| Exact Mass | 362.93 |
| IUPAC Name | N-(2,6-dibromo-4-methylphenyl)thian-4-amine |
| SMILES | Cc1cc(Br)c(NC2CCSCC2)c(Br)c1 |
| InChI | InChI=1S/C12H15Br2NS/c1-8-6-10(13)12(11(14)7-8)15-9-2-4-16-5-3-9/h6-7,9,15H,2-5H2,1H3 |
| InChIKey | WNMAABCRWZVFQL-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.13 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |