About N-[2-methyl-2-(4-methylpiperazin-1-yl)propyl]-1,1-dioxothian-4-amine
N-[2-methyl-2-(4-methylpiperazin-1-yl)propyl]-1,1-dioxothian-4-amine (PubChem CID 43511691) has the molecular formula C14H29N3O2S
and a molecular weight of 303.47 g/mol. Its IUPAC name is N-[2-methyl-2-(4-methylpiperazin-1-yl)propyl]-1,1-dioxothian-4-amine.
Molecular Properties
| Compound Name | N-[2-methyl-2-(4-methylpiperazin-1-yl)propyl]-1,1-dioxothian-4-amine |
| PubChem CID | 43511691 |
| Molecular Formula | C14H29N3O2S |
| Molecular Weight | 303.47 g/mol |
| Exact Mass | 303.20 |
| IUPAC Name | N-[2-methyl-2-(4-methylpiperazin-1-yl)propyl]-1,1-dioxothian-4-amine |
| SMILES | CN1CCN(C(C)(C)CNC2CCS(=O)(=O)CC2)CC1 |
| InChI | InChI=1S/C14H29N3O2S/c1-14(2,17-8-6-16(3)7-9-17)12-15-13-4-10-20(18,19)11-5-13/h13,15H,4-12H2,1-3H3 |
| InChIKey | LDHSQFMDHACGSF-UHFFFAOYSA-N |
| XLogP | 0.18 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 303.47 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-[2-methyl-2-(4-methylpiperazin-1-yl)propyl]-1,1-dioxothian-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-methyl-2-(4-methylpiperazin-1-yl)propyl]-1,1-dioxothian-4-amine?
The IUPAC name of N-[2-methyl-2-(4-methylpiperazin-1-yl)propyl]-1,1-dioxothian-4-amine (CID 43511691) is N-[2-methyl-2-(4-methylpiperazin-1-yl)propyl]-1,1-dioxothian-4-amine.
What is the SMILES notation for N-[2-methyl-2-(4-methylpiperazin-1-yl)propyl]-1,1-dioxothian-4-amine?
The canonical SMILES for N-[2-methyl-2-(4-methylpiperazin-1-yl)propyl]-1,1-dioxothian-4-amine is CN1CCN(C(C)(C)CNC2CCS(=O)(=O)CC2)CC1.
What is the InChIKey of N-[2-methyl-2-(4-methylpiperazin-1-yl)propyl]-1,1-dioxothian-4-amine?
The InChIKey is LDHSQFMDHACGSF-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H29N3O2S/c1-14(2,17-8-6-16(3)7-9-17)12-15-13-4-10-20(18,19)11-5-13/h13,15H,4-12H2,1-3H3.
What are the key properties of N-[2-methyl-2-(4-methylpiperazin-1-yl)propyl]-1,1-dioxothian-4-amine?
N-[2-methyl-2-(4-methylpiperazin-1-yl)propyl]-1,1-dioxothian-4-amine has a molecular weight of 303.47 g/mol, XLogP of 0.18, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-methyl-2-(4-methylpiperazin-1-yl)propyl]-1,1-dioxothian-4-amine is sourced from PubChem (CID 43511691), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).