C12H17NO — CID 43511864
5-methyl-N-propyl-2,3-dihydro-1-benzofuran-3-amine (PubChem CID 43511864) has the molecular formula C12H17NO and a molecular weight of 191.27 g/mol. Its IUPAC name is 5-methyl-N-propyl-2,3-dihydro-1-benzofuran-3-amine.
| Compound Name | 5-methyl-N-propyl-2,3-dihydro-1-benzofuran-3-amine |
|---|---|
| PubChem CID | 43511864 |
| Molecular Formula | C12H17NO |
| Molecular Weight | 191.27 g/mol |
| Exact Mass | 191.13 |
| IUPAC Name | 5-methyl-N-propyl-2,3-dihydro-1-benzofuran-3-amine |
| SMILES | CCCNC1COc2ccc(C)cc21 |
| InChI | InChI=1S/C12H17NO/c1-3-6-13-11-8-14-12-5-4-9(2)7-10(11)12/h4-5,7,11,13H,3,6,8H2,1-2H3 |
| InChIKey | XPLRUAQKEREISY-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.27 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |