About 6,7-dichloro-2,3-dihydro-1-benzofuran-3-amine
6,7-dichloro-2,3-dihydro-1-benzofuran-3-amine (PubChem CID 43512013) has the molecular formula C8H7Cl2NO
and a molecular weight of 204.06 g/mol. Its IUPAC name is 6,7-dichloro-2,3-dihydro-1-benzofuran-3-amine.
Molecular Properties
| Compound Name | 6,7-dichloro-2,3-dihydro-1-benzofuran-3-amine |
| PubChem CID | 43512013 |
| Molecular Formula | C8H7Cl2NO |
| Molecular Weight | 204.06 g/mol |
| Exact Mass | 202.99 |
| IUPAC Name | 6,7-dichloro-2,3-dihydro-1-benzofuran-3-amine |
| SMILES | NC1COc2c1ccc(Cl)c2Cl |
| InChI | InChI=1S/C8H7Cl2NO/c9-5-2-1-4-6(11)3-12-8(4)7(5)10/h1-2,6H,3,11H2 |
| InChIKey | URMAYQIYUBDETJ-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.06 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 6,7-dichloro-2,3-dihydro-1-benzofuran-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6,7-dichloro-2,3-dihydro-1-benzofuran-3-amine?
The IUPAC name of 6,7-dichloro-2,3-dihydro-1-benzofuran-3-amine (CID 43512013) is 6,7-dichloro-2,3-dihydro-1-benzofuran-3-amine.
What is the SMILES notation for 6,7-dichloro-2,3-dihydro-1-benzofuran-3-amine?
The canonical SMILES for 6,7-dichloro-2,3-dihydro-1-benzofuran-3-amine is NC1COc2c1ccc(Cl)c2Cl.
What is the InChIKey of 6,7-dichloro-2,3-dihydro-1-benzofuran-3-amine?
The InChIKey is URMAYQIYUBDETJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7Cl2NO/c9-5-2-1-4-6(11)3-12-8(4)7(5)10/h1-2,6H,3,11H2.
What are the key properties of 6,7-dichloro-2,3-dihydro-1-benzofuran-3-amine?
6,7-dichloro-2,3-dihydro-1-benzofuran-3-amine has a molecular weight of 204.06 g/mol, XLogP of 2.39, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6,7-dichloro-2,3-dihydro-1-benzofuran-3-amine is sourced from PubChem (CID 43512013), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).