About 5,7-ditert-butyl-2,3-dihydro-1-benzofuran-3-amine
5,7-ditert-butyl-2,3-dihydro-1-benzofuran-3-amine (PubChem CID 43512484) has the molecular formula C16H25NO
and a molecular weight of 247.38 g/mol. Its IUPAC name is 5,7-ditert-butyl-2,3-dihydro-1-benzofuran-3-amine.
Molecular Properties
| Compound Name | 5,7-ditert-butyl-2,3-dihydro-1-benzofuran-3-amine |
| PubChem CID | 43512484 |
| Molecular Formula | C16H25NO |
| Molecular Weight | 247.38 g/mol |
| Exact Mass | 247.19 |
| IUPAC Name | 5,7-ditert-butyl-2,3-dihydro-1-benzofuran-3-amine |
| SMILES | CC(C)(C)c1cc2c(c(C(C)(C)C)c1)OCC2N |
| InChI | InChI=1S/C16H25NO/c1-15(2,3)10-7-11-13(17)9-18-14(11)12(8-10)16(4,5)6/h7-8,13H,9,17H2,1-6H3 |
| InChIKey | CWFZZUNKAHBDRM-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 247.38 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5,7-ditert-butyl-2,3-dihydro-1-benzofuran-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,7-ditert-butyl-2,3-dihydro-1-benzofuran-3-amine?
The IUPAC name of 5,7-ditert-butyl-2,3-dihydro-1-benzofuran-3-amine (CID 43512484) is 5,7-ditert-butyl-2,3-dihydro-1-benzofuran-3-amine.
What is the SMILES notation for 5,7-ditert-butyl-2,3-dihydro-1-benzofuran-3-amine?
The canonical SMILES for 5,7-ditert-butyl-2,3-dihydro-1-benzofuran-3-amine is CC(C)(C)c1cc2c(c(C(C)(C)C)c1)OCC2N.
What is the InChIKey of 5,7-ditert-butyl-2,3-dihydro-1-benzofuran-3-amine?
The InChIKey is CWFZZUNKAHBDRM-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H25NO/c1-15(2,3)10-7-11-13(17)9-18-14(11)12(8-10)16(4,5)6/h7-8,13H,9,17H2,1-6H3.
What are the key properties of 5,7-ditert-butyl-2,3-dihydro-1-benzofuran-3-amine?
5,7-ditert-butyl-2,3-dihydro-1-benzofuran-3-amine has a molecular weight of 247.38 g/mol, XLogP of 3.67, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5,7-ditert-butyl-2,3-dihydro-1-benzofuran-3-amine is sourced from PubChem (CID 43512484), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).