C10H11BrClNO — CID 43512571
8-bromo-6-chloro-N-methyl-3,4-dihydro-2H-chromen-4-amine (PubChem CID 43512571) has the molecular formula C10H11BrClNO and a molecular weight of 276.56 g/mol. Its IUPAC name is 8-bromo-6-chloro-N-methyl-3,4-dihydro-2H-chromen-4-amine.
| Compound Name | 8-bromo-6-chloro-N-methyl-3,4-dihydro-2H-chromen-4-amine |
|---|---|
| PubChem CID | 43512571 |
| Molecular Formula | C10H11BrClNO |
| Molecular Weight | 276.56 g/mol |
| Exact Mass | 274.97 |
| IUPAC Name | 8-bromo-6-chloro-N-methyl-3,4-dihydro-2H-chromen-4-amine |
| SMILES | CNC1CCOc2c(Br)cc(Cl)cc21 |
| InChI | InChI=1S/C10H11BrClNO/c1-13-9-2-3-14-10-7(9)4-6(12)5-8(10)11/h4-5,9,13H,2-3H2,1H3 |
| InChIKey | XUYZRCTXPIMNTH-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.56 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |