C10H15N3O4S — CID 43513628
2-[3,5-dimethyl-4-(prop-2-enylsulfamoyl)pyrazol-1-yl]acetic acid (PubChem CID 43513628) has the molecular formula C10H15N3O4S and a molecular weight of 273.31 g/mol. Its IUPAC name is 2-[3,5-dimethyl-4-(prop-2-enylsulfamoyl)pyrazol-1-yl]acetic acid.
| Compound Name | 2-[3,5-dimethyl-4-(prop-2-enylsulfamoyl)pyrazol-1-yl]acetic acid |
|---|---|
| PubChem CID | 43513628 |
| Molecular Formula | C10H15N3O4S |
| Molecular Weight | 273.31 g/mol |
| Exact Mass | 273.08 |
| IUPAC Name | 2-[3,5-dimethyl-4-(prop-2-enylsulfamoyl)pyrazol-1-yl]acetic acid |
| SMILES | C=CCNS(=O)(=O)c1c(C)nn(CC(=O)O)c1C |
| InChI | InChI=1S/C10H15N3O4S/c1-4-5-11-18(16,17)10-7(2)12-13(8(10)3)6-9(14)15/h4,11H,1,5-6H2,2-3H3,(H,14,15) |
| InChIKey | STGRBXUAYFFDSO-UHFFFAOYSA-N |
| XLogP | 0.05 |
| TPSA | 101.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.31 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|