C11H17N3O4S2 — CID 43513718
3-[4-[methyl(thiolan-3-yl)sulfamoyl]pyrazol-1-yl]propanoic acid (PubChem CID 43513718) has the molecular formula C11H17N3O4S2 and a molecular weight of 319.41 g/mol. Its IUPAC name is 3-[4-[methyl(thiolan-3-yl)sulfamoyl]pyrazol-1-yl]propanoic acid.
| Compound Name | 3-[4-[methyl(thiolan-3-yl)sulfamoyl]pyrazol-1-yl]propanoic acid |
|---|---|
| PubChem CID | 43513718 |
| Molecular Formula | C11H17N3O4S2 |
| Molecular Weight | 319.41 g/mol |
| Exact Mass | 319.07 |
| IUPAC Name | 3-[4-[methyl(thiolan-3-yl)sulfamoyl]pyrazol-1-yl]propanoic acid |
| SMILES | CN(C1CCSC1)S(=O)(=O)c1cnn(CCC(=O)O)c1 |
| InChI | InChI=1S/C11H17N3O4S2/c1-13(9-3-5-19-8-9)20(17,18)10-6-12-14(7-10)4-2-11(15)16/h6-7,9H,2-5,8H2,1H3,(H,15,16) |
| InChIKey | VEMBLHLVTJXPFS-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.41 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |