About 2-cyclopropyl-2-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]propan-1-amine
2-cyclopropyl-2-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]propan-1-amine (PubChem CID 43514086) has the molecular formula C12H22F3N3
and a molecular weight of 265.32 g/mol. Its IUPAC name is 2-cyclopropyl-2-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]propan-1-amine.
Molecular Properties
| Compound Name | 2-cyclopropyl-2-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]propan-1-amine |
| PubChem CID | 43514086 |
| Molecular Formula | C12H22F3N3 |
| Molecular Weight | 265.32 g/mol |
| Exact Mass | 265.18 |
| IUPAC Name | 2-cyclopropyl-2-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]propan-1-amine |
| SMILES | CC(CN)(C1CC1)N1CCN(CC(F)(F)F)CC1 |
| InChI | InChI=1S/C12H22F3N3/c1-11(8-16,10-2-3-10)18-6-4-17(5-7-18)9-12(13,14)15/h10H,2-9,16H2,1H3 |
| InChIKey | CTZKWEWBMWVRDC-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 32.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 265.32 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-cyclopropyl-2-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]propan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cyclopropyl-2-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]propan-1-amine?
The IUPAC name of 2-cyclopropyl-2-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]propan-1-amine (CID 43514086) is 2-cyclopropyl-2-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]propan-1-amine.
What is the SMILES notation for 2-cyclopropyl-2-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]propan-1-amine?
The canonical SMILES for 2-cyclopropyl-2-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]propan-1-amine is CC(CN)(C1CC1)N1CCN(CC(F)(F)F)CC1.
What is the InChIKey of 2-cyclopropyl-2-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]propan-1-amine?
The InChIKey is CTZKWEWBMWVRDC-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H22F3N3/c1-11(8-16,10-2-3-10)18-6-4-17(5-7-18)9-12(13,14)15/h10H,2-9,16H2,1H3.
What are the key properties of 2-cyclopropyl-2-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]propan-1-amine?
2-cyclopropyl-2-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]propan-1-amine has a molecular weight of 265.32 g/mol, XLogP of 1.29, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyclopropyl-2-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]propan-1-amine is sourced from PubChem (CID 43514086), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).