C11H14N4O4S — CID 43514403
4-[2-(carbamoylamino)-2-oxoethyl]sulfanyl-2-ethyl-6-methylpyrimidine-5-carboxylic acid (PubChem CID 43514403) has the molecular formula C11H14N4O4S and a molecular weight of 298.32 g/mol. Its IUPAC name is 4-[2-(carbamoylamino)-2-oxoethyl]sulfanyl-2-ethyl-6-methylpyrimidine-5-carboxylic acid.
| Compound Name | 4-[2-(carbamoylamino)-2-oxoethyl]sulfanyl-2-ethyl-6-methylpyrimidine-5-carboxylic acid |
|---|---|
| PubChem CID | 43514403 |
| Molecular Formula | C11H14N4O4S |
| Molecular Weight | 298.32 g/mol |
| Exact Mass | 298.07 |
| IUPAC Name | 4-[2-(carbamoylamino)-2-oxoethyl]sulfanyl-2-ethyl-6-methylpyrimidine-5-carboxylic acid |
| SMILES | CCc1nc(C)c(C(=O)O)c(SCC(=O)NC(N)=O)n1 |
| InChI | InChI=1S/C11H14N4O4S/c1-3-6-13-5(2)8(10(17)18)9(14-6)20-4-7(16)15-11(12)19/h3-4H2,1-2H3,(H,17,18)(H3,12,15,16,19) |
| InChIKey | JSUOPKXNXPZPRN-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 135.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.32 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |