C13H16N2O2S — CID 43514442
4-[(E)-but-2-enyl]sulfanyl-2-cyclopropyl-6-methylpyrimidine-5-carboxylic acid (PubChem CID 43514442) has the molecular formula C13H16N2O2S and a molecular weight of 264.35 g/mol. Its IUPAC name is 4-[(E)-but-2-enyl]sulfanyl-2-cyclopropyl-6-methylpyrimidine-5-carboxylic acid.
| Compound Name | 4-[(E)-but-2-enyl]sulfanyl-2-cyclopropyl-6-methylpyrimidine-5-carboxylic acid |
|---|---|
| PubChem CID | 43514442 |
| Molecular Formula | C13H16N2O2S |
| Molecular Weight | 264.35 g/mol |
| Exact Mass | 264.09 |
| IUPAC Name | 4-[(E)-but-2-enyl]sulfanyl-2-cyclopropyl-6-methylpyrimidine-5-carboxylic acid |
| SMILES | C/C=C/CSc1nc(C2CC2)nc(C)c1C(=O)O |
| InChI | InChI=1S/C13H16N2O2S/c1-3-4-7-18-12-10(13(16)17)8(2)14-11(15-12)9-5-6-9/h3-4,9H,5-7H2,1-2H3,(H,16,17)/b4-3+ |
| InChIKey | BRCCYVZMYAZITK-ONEGZZNKSA-N |
| XLogP | 3.03 |
| TPSA | 63.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.35 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|