C13H11Cl2NO3 — CID 43515928
2-(2,4-dichloro-6-formylphenoxy)-N-prop-2-ynylpropanamide (PubChem CID 43515928) has the molecular formula C13H11Cl2NO3 and a molecular weight of 300.14 g/mol. Its IUPAC name is 2-(2,4-dichloro-6-formylphenoxy)-N-prop-2-ynylpropanamide.
| Compound Name | 2-(2,4-dichloro-6-formylphenoxy)-N-prop-2-ynylpropanamide |
|---|---|
| PubChem CID | 43515928 |
| Molecular Formula | C13H11Cl2NO3 |
| Molecular Weight | 300.14 g/mol |
| Exact Mass | 299.01 |
| IUPAC Name | 2-(2,4-dichloro-6-formylphenoxy)-N-prop-2-ynylpropanamide |
| SMILES | C#CCNC(=O)C(C)Oc1c(Cl)cc(Cl)cc1C=O |
| InChI | InChI=1S/C13H11Cl2NO3/c1-3-4-16-13(18)8(2)19-12-9(7-17)5-10(14)6-11(12)15/h1,5-8H,4H2,2H3,(H,16,18) |
| InChIKey | MEAJJNSFVDINNO-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.14 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|