About 3-(4-phthalazin-1-yl-1,4-diazepan-1-yl)propan-1-amine
3-(4-phthalazin-1-yl-1,4-diazepan-1-yl)propan-1-amine (PubChem CID 43517046) has the molecular formula C16H23N5
and a molecular weight of 285.39 g/mol. Its IUPAC name is 3-(4-phthalazin-1-yl-1,4-diazepan-1-yl)propan-1-amine.
Molecular Properties
| Compound Name | 3-(4-phthalazin-1-yl-1,4-diazepan-1-yl)propan-1-amine |
| PubChem CID | 43517046 |
| Molecular Formula | C16H23N5 |
| Molecular Weight | 285.39 g/mol |
| Exact Mass | 285.20 |
| IUPAC Name | 3-(4-phthalazin-1-yl-1,4-diazepan-1-yl)propan-1-amine |
| SMILES | NCCCN1CCCN(c2nncc3ccccc23)CC1 |
| InChI | InChI=1S/C16H23N5/c17-7-3-8-20-9-4-10-21(12-11-20)16-15-6-2-1-5-14(15)13-18-19-16/h1-2,5-6,13H,3-4,7-12,17H2 |
| InChIKey | GAILMOJIOZFTSV-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 58.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 285.39 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-(4-phthalazin-1-yl-1,4-diazepan-1-yl)propan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(4-phthalazin-1-yl-1,4-diazepan-1-yl)propan-1-amine?
The IUPAC name of 3-(4-phthalazin-1-yl-1,4-diazepan-1-yl)propan-1-amine (CID 43517046) is 3-(4-phthalazin-1-yl-1,4-diazepan-1-yl)propan-1-amine.
What is the SMILES notation for 3-(4-phthalazin-1-yl-1,4-diazepan-1-yl)propan-1-amine?
The canonical SMILES for 3-(4-phthalazin-1-yl-1,4-diazepan-1-yl)propan-1-amine is NCCCN1CCCN(c2nncc3ccccc23)CC1.
What is the InChIKey of 3-(4-phthalazin-1-yl-1,4-diazepan-1-yl)propan-1-amine?
The InChIKey is GAILMOJIOZFTSV-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H23N5/c17-7-3-8-20-9-4-10-21(12-11-20)16-15-6-2-1-5-14(15)13-18-19-16/h1-2,5-6,13H,3-4,7-12,17H2.
What are the key properties of 3-(4-phthalazin-1-yl-1,4-diazepan-1-yl)propan-1-amine?
3-(4-phthalazin-1-yl-1,4-diazepan-1-yl)propan-1-amine has a molecular weight of 285.39 g/mol, XLogP of 1.49, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(4-phthalazin-1-yl-1,4-diazepan-1-yl)propan-1-amine is sourced from PubChem (CID 43517046), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).