C13H9F2N3 — CID 43518142
3-amino-4-(2,6-difluoroanilino)benzonitrile (PubChem CID 43518142) has the molecular formula C13H9F2N3 and a molecular weight of 245.23 g/mol. Its IUPAC name is 3-amino-4-(2,6-difluoroanilino)benzonitrile.
| Compound Name | 3-amino-4-(2,6-difluoroanilino)benzonitrile |
|---|---|
| PubChem CID | 43518142 |
| Molecular Formula | C13H9F2N3 |
| Molecular Weight | 245.23 g/mol |
| Exact Mass | 245.08 |
| IUPAC Name | 3-amino-4-(2,6-difluoroanilino)benzonitrile |
| SMILES | N#Cc1ccc(Nc2c(F)cccc2F)c(N)c1 |
| InChI | InChI=1S/C13H9F2N3/c14-9-2-1-3-10(15)13(9)18-12-5-4-8(7-16)6-11(12)17/h1-6,18H,17H2 |
| InChIKey | WWDKNVASQPJRNT-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 61.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.23 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|