C14H13F2NO3S — CID 43519114
3-[(2,5-difluorophenyl)sulfonylmethyl]-4-methoxyaniline (PubChem CID 43519114) has the molecular formula C14H13F2NO3S and a molecular weight of 313.32 g/mol. Its IUPAC name is 3-[(2,5-difluorophenyl)sulfonylmethyl]-4-methoxyaniline.
| Compound Name | 3-[(2,5-difluorophenyl)sulfonylmethyl]-4-methoxyaniline |
|---|---|
| PubChem CID | 43519114 |
| Molecular Formula | C14H13F2NO3S |
| Molecular Weight | 313.32 g/mol |
| Exact Mass | 313.06 |
| IUPAC Name | 3-[(2,5-difluorophenyl)sulfonylmethyl]-4-methoxyaniline |
| SMILES | COc1ccc(N)cc1CS(=O)(=O)c1cc(F)ccc1F |
| InChI | InChI=1S/C14H13F2NO3S/c1-20-13-5-3-11(17)6-9(13)8-21(18,19)14-7-10(15)2-4-12(14)16/h2-7H,8,17H2,1H3 |
| InChIKey | BYZPGNVACDDOLW-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.32 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|