C12H7BrF2N2O — CID 43520386
N-(6-bromo-2-pyridinyl)-2,5-difluorobenzamide (PubChem CID 43520386) has the molecular formula C12H7BrF2N2O and a molecular weight of 313.10 g/mol. Its IUPAC name is N-(6-bromo-2-pyridinyl)-2,5-difluorobenzamide.
| Compound Name | N-(6-bromo-2-pyridinyl)-2,5-difluorobenzamide |
|---|---|
| PubChem CID | 43520386 |
| Molecular Formula | C12H7BrF2N2O |
| Molecular Weight | 313.10 g/mol |
| Exact Mass | 311.97 |
| IUPAC Name | N-(6-bromo-2-pyridinyl)-2,5-difluorobenzamide |
| SMILES | O=C(Nc1cccc(Br)n1)c1cc(F)ccc1F |
| InChI | InChI=1S/C12H7BrF2N2O/c13-10-2-1-3-11(16-10)17-12(18)8-6-7(14)4-5-9(8)15/h1-6H,(H,16,17,18) |
| InChIKey | CVFCGAMQYWRZHP-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.10 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|