About N-(6-bromo-2-pyridinyl)-2,6-difluorobenzamide
N-(6-bromo-2-pyridinyl)-2,6-difluorobenzamide (PubChem CID 43520425) has the molecular formula C12H7BrF2N2O
and a molecular weight of 313.10 g/mol. Its IUPAC name is N-(6-bromo-2-pyridinyl)-2,6-difluorobenzamide.
Molecular Properties
| Compound Name | N-(6-bromo-2-pyridinyl)-2,6-difluorobenzamide |
| PubChem CID | 43520425 |
| Molecular Formula | C12H7BrF2N2O |
| Molecular Weight | 313.10 g/mol |
| Exact Mass | 311.97 |
| IUPAC Name | N-(6-bromo-2-pyridinyl)-2,6-difluorobenzamide |
| SMILES | O=C(Nc1cccc(Br)n1)c1c(F)cccc1F |
| InChI | InChI=1S/C12H7BrF2N2O/c13-9-5-2-6-10(16-9)17-12(18)11-7(14)3-1-4-8(11)15/h1-6H,(H,16,17,18) |
| InChIKey | UMKYHLMWGSIPBW-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 313.10 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze N-(6-bromo-2-pyridinyl)-2,6-difluorobenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(6-bromo-2-pyridinyl)-2,6-difluorobenzamide?
The IUPAC name of N-(6-bromo-2-pyridinyl)-2,6-difluorobenzamide (CID 43520425) is N-(6-bromo-2-pyridinyl)-2,6-difluorobenzamide.
What is the SMILES notation for N-(6-bromo-2-pyridinyl)-2,6-difluorobenzamide?
The canonical SMILES for N-(6-bromo-2-pyridinyl)-2,6-difluorobenzamide is O=C(Nc1cccc(Br)n1)c1c(F)cccc1F.
What is the InChIKey of N-(6-bromo-2-pyridinyl)-2,6-difluorobenzamide?
The InChIKey is UMKYHLMWGSIPBW-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H7BrF2N2O/c13-9-5-2-6-10(16-9)17-12(18)11-7(14)3-1-4-8(11)15/h1-6H,(H,16,17,18).
What are the key properties of N-(6-bromo-2-pyridinyl)-2,6-difluorobenzamide?
N-(6-bromo-2-pyridinyl)-2,6-difluorobenzamide has a molecular weight of 313.10 g/mol, XLogP of 3.37, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(6-bromo-2-pyridinyl)-2,6-difluorobenzamide is sourced from PubChem (CID 43520425), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).