About 3-[4-[(5-methyl-1,3,4-oxadiazol-2-yl)methyl]piperazin-1-yl]propanoic acid
3-[4-[(5-methyl-1,3,4-oxadiazol-2-yl)methyl]piperazin-1-yl]propanoic acid (PubChem CID 43522477) has the molecular formula C11H18N4O3
and a molecular weight of 254.29 g/mol. Its IUPAC name is 3-[4-[(5-methyl-1,3,4-oxadiazol-2-yl)methyl]piperazin-1-yl]propanoic acid.
Molecular Properties
| Compound Name | 3-[4-[(5-methyl-1,3,4-oxadiazol-2-yl)methyl]piperazin-1-yl]propanoic acid |
| PubChem CID | 43522477 |
| Molecular Formula | C11H18N4O3 |
| Molecular Weight | 254.29 g/mol |
| Exact Mass | 254.14 |
| IUPAC Name | 3-[4-[(5-methyl-1,3,4-oxadiazol-2-yl)methyl]piperazin-1-yl]propanoic acid |
| SMILES | Cc1nnc(CN2CCN(CCC(=O)O)CC2)o1 |
| InChI | InChI=1S/C11H18N4O3/c1-9-12-13-10(18-9)8-15-6-4-14(5-7-15)3-2-11(16)17/h2-8H2,1H3,(H,16,17) |
| InChIKey | CEQDHANVWYQSKM-UHFFFAOYSA-N |
| XLogP | -0.03 |
| TPSA | 82.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.29 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 3-[4-[(5-methyl-1,3,4-oxadiazol-2-yl)methyl]piperazin-1-yl]propanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[4-[(5-methyl-1,3,4-oxadiazol-2-yl)methyl]piperazin-1-yl]propanoic acid?
The IUPAC name of 3-[4-[(5-methyl-1,3,4-oxadiazol-2-yl)methyl]piperazin-1-yl]propanoic acid (CID 43522477) is 3-[4-[(5-methyl-1,3,4-oxadiazol-2-yl)methyl]piperazin-1-yl]propanoic acid.
What is the SMILES notation for 3-[4-[(5-methyl-1,3,4-oxadiazol-2-yl)methyl]piperazin-1-yl]propanoic acid?
The canonical SMILES for 3-[4-[(5-methyl-1,3,4-oxadiazol-2-yl)methyl]piperazin-1-yl]propanoic acid is Cc1nnc(CN2CCN(CCC(=O)O)CC2)o1.
What is the InChIKey of 3-[4-[(5-methyl-1,3,4-oxadiazol-2-yl)methyl]piperazin-1-yl]propanoic acid?
The InChIKey is CEQDHANVWYQSKM-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18N4O3/c1-9-12-13-10(18-9)8-15-6-4-14(5-7-15)3-2-11(16)17/h2-8H2,1H3,(H,16,17).
What are the key properties of 3-[4-[(5-methyl-1,3,4-oxadiazol-2-yl)methyl]piperazin-1-yl]propanoic acid?
3-[4-[(5-methyl-1,3,4-oxadiazol-2-yl)methyl]piperazin-1-yl]propanoic acid has a molecular weight of 254.29 g/mol, XLogP of -0.03, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[4-[(5-methyl-1,3,4-oxadiazol-2-yl)methyl]piperazin-1-yl]propanoic acid is sourced from PubChem (CID 43522477), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).