About N-piperidin-4-yl-1,2,5-thiadiazole-3-carboxamide
N-piperidin-4-yl-1,2,5-thiadiazole-3-carboxamide (PubChem CID 43522588) has the molecular formula C8H12N4OS
and a molecular weight of 212.28 g/mol. Its IUPAC name is N-piperidin-4-yl-1,2,5-thiadiazole-3-carboxamide.
Molecular Properties
| Compound Name | N-piperidin-4-yl-1,2,5-thiadiazole-3-carboxamide |
| PubChem CID | 43522588 |
| Molecular Formula | C8H12N4OS |
| Molecular Weight | 212.28 g/mol |
| Exact Mass | 212.07 |
| IUPAC Name | N-piperidin-4-yl-1,2,5-thiadiazole-3-carboxamide |
| SMILES | O=C(NC1CCNCC1)c1cnsn1 |
| InChI | InChI=1S/C8H12N4OS/c13-8(7-5-10-14-12-7)11-6-1-3-9-4-2-6/h5-6,9H,1-4H2,(H,11,13) |
| InChIKey | UUKUSTDOOSZBFO-UHFFFAOYSA-N |
| XLogP | 0.02 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.28 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-piperidin-4-yl-1,2,5-thiadiazole-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-piperidin-4-yl-1,2,5-thiadiazole-3-carboxamide?
The IUPAC name of N-piperidin-4-yl-1,2,5-thiadiazole-3-carboxamide (CID 43522588) is N-piperidin-4-yl-1,2,5-thiadiazole-3-carboxamide.
What is the SMILES notation for N-piperidin-4-yl-1,2,5-thiadiazole-3-carboxamide?
The canonical SMILES for N-piperidin-4-yl-1,2,5-thiadiazole-3-carboxamide is O=C(NC1CCNCC1)c1cnsn1.
What is the InChIKey of N-piperidin-4-yl-1,2,5-thiadiazole-3-carboxamide?
The InChIKey is UUKUSTDOOSZBFO-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12N4OS/c13-8(7-5-10-14-12-7)11-6-1-3-9-4-2-6/h5-6,9H,1-4H2,(H,11,13).
What are the key properties of N-piperidin-4-yl-1,2,5-thiadiazole-3-carboxamide?
N-piperidin-4-yl-1,2,5-thiadiazole-3-carboxamide has a molecular weight of 212.28 g/mol, XLogP of 0.02, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-piperidin-4-yl-1,2,5-thiadiazole-3-carboxamide is sourced from PubChem (CID 43522588), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).